C26H34FN2O8P — CID 156803802
1-[4-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-4,4-dihydroxy-3-methoxybutyl]-5-ethynylpyrimidine-2,4-dione (PubChem CID 156803802) has the molecular formula C26H34FN2O8P and a molecular weight of 552.54 g/mol. Its IUPAC name is 1-[4-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-4,4-dihydroxy-3-methoxybutyl]-5-ethynylpyrimidine-2,4-dione.
| Compound Name | 1-[4-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-4,4-dihydroxy-3-methoxybutyl]-5-ethynylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 156803802 |
| Molecular Formula | C26H34FN2O8P |
| Molecular Weight | 552.54 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 1-[4-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-4,4-dihydroxy-3-methoxybutyl]-5-ethynylpyrimidine-2,4-dione |
| SMILES | C#Cc1cn(CCC(OC)C(O)(O)OP2OCc3c(F)c(C(C)(C)C)cc(C(C)(C)C)c3O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C26H34FN2O8P/c1-9-15-13-29(23(31)28-22(15)30)11-10-19(34-8)26(32,33)37-38-35-14-16-20(27)17(24(2,3)4)12-18(21(16)36-38)25(5,6)7/h1,12-13,19,32-33H,10-11,14H2,2-8H3,(H,28,30,31) |
| InChIKey | VKJFWNDOTKEKBZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|