C18H17B2FN2O7P+ — CID 153342111
CID 153342111 (PubChem CID 153342111) has the molecular formula C18H17B2FN2O7P+ and a molecular weight of 444.94 g/mol.
| Compound Name | CID 153342111 |
|---|---|
| PubChem CID | 153342111 |
| Molecular Formula | C18H17B2FN2O7P+ |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O[P+]1(O)OCc2cc(F)ccc2O1)C(CCn1cc(C#C)c(=O)[nH]c1=O)OC |
| InChI | InChI=1S/C18H16B2FN2O7P/c1-3-11-9-23(17(25)22-16(11)24)7-6-15(27-2)18(19,20)30-31(26)28-10-12-8-13(21)4-5-14(12)29-31/h1,4-5,8-9,15,26H,6-7,10H2,2H3/p+1 |
| InChIKey | VKKOBILOUBHBMA-UHFFFAOYSA-O |
| XLogP | 0.35 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|