C31H44ClF2O4P — CID 123489094
4,6-ditert-butyl-2-[[3-(8-tert-butyl-2-chloro-5-fluoro-4H-1,3,2-benzodioxaphosphinin-6-yl)-3-methylbutoxy]methyl]-3-fluorophenol (PubChem CID 123489094) has the molecular formula C31H44ClF2O4P and a molecular weight of 585.11 g/mol. Its IUPAC name is 4,6-ditert-butyl-2-[[3-(8-tert-butyl-2-chloro-5-fluoro-4H-1,3,2-benzodioxaphosphinin-6-yl)-3-methylbutoxy]methyl]-3-fluorophenol.
| Compound Name | 4,6-ditert-butyl-2-[[3-(8-tert-butyl-2-chloro-5-fluoro-4H-1,3,2-benzodioxaphosphinin-6-yl)-3-methylbutoxy]methyl]-3-fluorophenol |
|---|---|
| PubChem CID | 123489094 |
| Molecular Formula | C31H44ClF2O4P |
| Molecular Weight | 585.11 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | 4,6-ditert-butyl-2-[[3-(8-tert-butyl-2-chloro-5-fluoro-4H-1,3,2-benzodioxaphosphinin-6-yl)-3-methylbutoxy]methyl]-3-fluorophenol |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(F)c(COCCC(C)(C)c2cc(C(C)(C)C)c3c(c2F)COP(Cl)O3)c1O |
| InChI | InChI=1S/C31H44ClF2O4P/c1-28(2,3)20-14-22(29(4,5)6)26(35)18(24(20)33)16-36-13-12-31(10,11)21-15-23(30(7,8)9)27-19(25(21)34)17-37-39(32)38-27/h14-15,35H,12-13,16-17H2,1-11H3 |
| InChIKey | CCSGYHFNJCAAKU-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.11 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|