C12H11N2O6Y- — CID 89050890
5-(2H-furan-2-id-5-yl)-1-[2-(hydroxymethyl)-1,3-dioxolan-4-yl]pyrimidine-2,4-dione;yttrium (PubChem CID 89050890) has the molecular formula C12H11N2O6Y- and a molecular weight of 368.13 g/mol. Its IUPAC name is 5-(2H-furan-2-id-5-yl)-1-[2-(hydroxymethyl)-1,3-dioxolan-4-yl]pyrimidine-2,4-dione;yttrium.
| Compound Name | 5-(2H-furan-2-id-5-yl)-1-[2-(hydroxymethyl)-1,3-dioxolan-4-yl]pyrimidine-2,4-dione;yttrium |
|---|---|
| PubChem CID | 89050890 |
| Molecular Formula | C12H11N2O6Y- |
| Molecular Weight | 368.13 g/mol |
| Exact Mass | 367.97 |
| IUPAC Name | 5-(2H-furan-2-id-5-yl)-1-[2-(hydroxymethyl)-1,3-dioxolan-4-yl]pyrimidine-2,4-dione;yttrium |
| SMILES | O=c1[nH]c(=O)n(C2COC(CO)O2)cc1-c1cc[c-]o1.[Y] |
| InChI | InChI=1S/C12H11N2O6.Y/c15-5-10-19-6-9(20-10)14-4-7(8-2-1-3-18-8)11(16)13-12(14)17;/h1-2,4,9-10,15H,5-6H2,(H,13,16,17);/q-1; |
| InChIKey | HPNAMWYBTDPXMO-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.13 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|