C22H38O4Si — CID 135016050
methyl (1R,3S,4R,6S,8S)-3-[tert-butyl(dimethyl)silyl]oxy-6,10,10-trimethyl-9-oxotricyclo[6.3.0.03,6]undecane-4-carboxylate (PubChem CID 135016050) has the molecular formula C22H38O4Si and a molecular weight of 394.63 g/mol. Its IUPAC name is methyl (1R,3S,4R,6S,8S)-3-[tert-butyl(dimethyl)silyl]oxy-6,10,10-trimethyl-9-oxotricyclo[6.3.0.03,6]undecane-4-carboxylate.
| Compound Name | methyl (1R,3S,4R,6S,8S)-3-[tert-butyl(dimethyl)silyl]oxy-6,10,10-trimethyl-9-oxotricyclo[6.3.0.03,6]undecane-4-carboxylate |
|---|---|
| PubChem CID | 135016050 |
| Molecular Formula | C22H38O4Si |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | methyl (1R,3S,4R,6S,8S)-3-[tert-butyl(dimethyl)silyl]oxy-6,10,10-trimethyl-9-oxotricyclo[6.3.0.03,6]undecane-4-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@]2(C)C[C@@H]3C(=O)C(C)(C)C[C@@H]3C[C@]12O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H38O4Si/c1-19(2,3)27(8,9)26-22-11-14-10-20(4,5)17(23)15(14)12-21(22,6)13-16(22)18(24)25-7/h14-16H,10-13H2,1-9H3/t14-,15+,16+,21+,22+/m1/s1 |
| InChIKey | FCJVSBKUJSOUNC-XBDDDHEFSA-N |
| XLogP | 4.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|