C23H31F5O3Si — CID 134918225
(2,3,4,5,6-pentafluorophenyl) (1S,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-1-methylbicyclo[5.2.0]nonane-8-carboxylate (PubChem CID 134918225) has the molecular formula C23H31F5O3Si and a molecular weight of 478.57 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (1S,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-1-methylbicyclo[5.2.0]nonane-8-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (1S,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-1-methylbicyclo[5.2.0]nonane-8-carboxylate |
|---|---|
| PubChem CID | 134918225 |
| Molecular Formula | C23H31F5O3Si |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (1S,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-1-methylbicyclo[5.2.0]nonane-8-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@]12CCCCC[C@@]1(C)C[C@@H]2C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C23H31F5O3Si/c1-21(2,3)32(5,6)31-23-11-9-7-8-10-22(23,4)12-13(23)20(29)30-19-17(27)15(25)14(24)16(26)18(19)28/h13H,7-12H2,1-6H3/t13-,22+,23+/m1/s1 |
| InChIKey | HNSVHEFCKYGPST-KNWAOAHBSA-N |
| XLogP | 7.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|