C13H26NO3Si- — CID 91868283
methyl (4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylpyrrolidin-1-ide-2-carboxylate (PubChem CID 91868283) has the molecular formula C13H26NO3Si- and a molecular weight of 272.44 g/mol. Its IUPAC name is methyl (4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylpyrrolidin-1-ide-2-carboxylate.
| Compound Name | methyl (4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylpyrrolidin-1-ide-2-carboxylate |
|---|---|
| PubChem CID | 91868283 |
| Molecular Formula | C13H26NO3Si- |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | methyl (4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylpyrrolidin-1-ide-2-carboxylate |
| SMILES | COC(=O)C1(C)C[C@@H](O[Si](C)(C)C(C)(C)C)C[N-]1 |
| InChI | InChI=1S/C13H26NO3Si/c1-12(2,3)18(6,7)17-10-8-13(4,14-9-10)11(15)16-5/h10H,8-9H2,1-7H3/q-1/t10-,13?/m1/s1 |
| InChIKey | ADVXJWYIBRFAQH-VUUHIHSGSA-N |
| XLogP | 3.09 |
| TPSA | 49.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|