C10H22N2O3Si — CID 141358006
[3-[tert-butyl(dimethyl)silyl]oxyazetidin-1-yl]carbamic acid (PubChem CID 141358006) has the molecular formula C10H22N2O3Si and a molecular weight of 246.38 g/mol. Its IUPAC name is [3-[tert-butyl(dimethyl)silyl]oxyazetidin-1-yl]carbamic acid.
| Compound Name | [3-[tert-butyl(dimethyl)silyl]oxyazetidin-1-yl]carbamic acid |
|---|---|
| PubChem CID | 141358006 |
| Molecular Formula | C10H22N2O3Si |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | [3-[tert-butyl(dimethyl)silyl]oxyazetidin-1-yl]carbamic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC1CN(NC(=O)O)C1 |
| InChI | InChI=1S/C10H22N2O3Si/c1-10(2,3)16(4,5)15-8-6-12(7-8)11-9(13)14/h8,11H,6-7H2,1-5H3,(H,13,14) |
| InChIKey | QQQUBILJIYYOCL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|