C17H31N3O2Si — CID 166280109
N-[4-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]-5-methyl-1H-pyrrole-3-carboxamide (PubChem CID 166280109) has the molecular formula C17H31N3O2Si and a molecular weight of 337.54 g/mol. Its IUPAC name is N-[4-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]-5-methyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-[4-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]-5-methyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 166280109 |
| Molecular Formula | C17H31N3O2Si |
| Molecular Weight | 337.54 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | N-[4-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]-5-methyl-1H-pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NN2CCC(O[Si](C)(C)C(C)(C)C)CC2)c[nH]1 |
| InChI | InChI=1S/C17H31N3O2Si/c1-13-11-14(12-18-13)16(21)19-20-9-7-15(8-10-20)22-23(5,6)17(2,3)4/h11-12,15,18H,7-10H2,1-6H3,(H,19,21) |
| InChIKey | FUVDRHWQYUVRRB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|