C14H25N3O2Si — CID 171461010
[(3R)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-imidazol-1-ylmethanone (PubChem CID 171461010) has the molecular formula C14H25N3O2Si and a molecular weight of 295.46 g/mol. Its IUPAC name is [(3R)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-imidazol-1-ylmethanone.
| Compound Name | [(3R)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-imidazol-1-ylmethanone |
|---|---|
| PubChem CID | 171461010 |
| Molecular Formula | C14H25N3O2Si |
| Molecular Weight | 295.46 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | [(3R)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-imidazol-1-ylmethanone |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCN(C(=O)n2ccnc2)C1 |
| InChI | InChI=1S/C14H25N3O2Si/c1-14(2,3)20(4,5)19-12-6-8-16(10-12)13(18)17-9-7-15-11-17/h7,9,11-12H,6,8,10H2,1-5H3/t12-/m1/s1 |
| InChIKey | PRNRDIDRRRCXRL-GFCCVEGCSA-N |
| XLogP | 2.95 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|