C13H25NO3Si — CID 175874654
3-[tert-butyl(dimethyl)silyl]oxy-2,3,4,7-tetrahydroazepine-1-carboxylic acid (PubChem CID 175874654) has the molecular formula C13H25NO3Si and a molecular weight of 271.43 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-2,3,4,7-tetrahydroazepine-1-carboxylic acid.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-2,3,4,7-tetrahydroazepine-1-carboxylic acid |
|---|---|
| PubChem CID | 175874654 |
| Molecular Formula | C13H25NO3Si |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-2,3,4,7-tetrahydroazepine-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC=CCN(C(=O)O)C1 |
| InChI | InChI=1S/C13H25NO3Si/c1-13(2,3)18(4,5)17-11-8-6-7-9-14(10-11)12(15)16/h6-7,11H,8-10H2,1-5H3,(H,15,16) |
| InChIKey | SHYIYRZESGGCGV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|