C20H40O4Si2 — CID 68542742
2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]acetic acid (PubChem CID 68542742) has the molecular formula C20H40O4Si2 and a molecular weight of 400.71 g/mol. Its IUPAC name is 2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]acetic acid.
| Compound Name | 2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]acetic acid |
|---|---|
| PubChem CID | 68542742 |
| Molecular Formula | C20H40O4Si2 |
| Molecular Weight | 400.71 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC(=CC(=O)O)C[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C20H40O4Si2/c1-19(2,3)25(7,8)23-16-11-15(13-18(21)22)12-17(14-16)24-26(9,10)20(4,5)6/h13,16-17H,11-12,14H2,1-10H3,(H,21,22)/t16-,17-/m1/s1 |
| InChIKey | XHZIFKQAVFMIRG-IAGOWNOFSA-N |
| XLogP | 5.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.71 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|