C25H51BO4Si2 — CID 11260225
tert-butyl-[(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclohexyl]oxy-dimethylsilane (PubChem CID 11260225) has the molecular formula C25H51BO4Si2 and a molecular weight of 482.66 g/mol. Its IUPAC name is tert-butyl-[(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclohexyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclohexyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11260225 |
| Molecular Formula | C25H51BO4Si2 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | tert-butyl-[(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclohexyl]oxy-dimethylsilane |
| SMILES | CC1(C)OB(C=C2C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)C2)OC1(C)C |
| InChI | InChI=1S/C25H51BO4Si2/c1-22(2,3)31(11,12)27-20-15-19(18-26-29-24(7,8)25(9,10)30-26)16-21(17-20)28-32(13,14)23(4,5)6/h18,20-21H,15-17H2,1-14H3/t20-,21-/m1/s1 |
| InChIKey | UWRVEINNASFGSW-NHCUHLMSSA-N |
| XLogP | 7.51 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|