C13H29NO3Si — CID 155699527
2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]propane-1,3-diol (PubChem CID 155699527) has the molecular formula C13H29NO3Si and a molecular weight of 275.47 g/mol. Its IUPAC name is 2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]propane-1,3-diol.
| Compound Name | 2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]propane-1,3-diol |
|---|---|
| PubChem CID | 155699527 |
| Molecular Formula | C13H29NO3Si |
| Molecular Weight | 275.47 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]propane-1,3-diol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCN(C(CO)CO)C1 |
| InChI | InChI=1S/C13H29NO3Si/c1-13(2,3)18(4,5)17-12-6-7-14(8-12)11(9-15)10-16/h11-12,15-16H,6-10H2,1-5H3/t12-/m1/s1 |
| InChIKey | AUKDFTNBLSBNHT-GFCCVEGCSA-N |
| XLogP | 1.44 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.47 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|