C19H30F3NO3Si — CID 131741907
(1S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-1-[4-(trifluoromethoxy)phenyl]ethanol (PubChem CID 131741907) has the molecular formula C19H30F3NO3Si and a molecular weight of 405.53 g/mol. Its IUPAC name is (1S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-1-[4-(trifluoromethoxy)phenyl]ethanol.
| Compound Name | (1S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-1-[4-(trifluoromethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 131741907 |
| Molecular Formula | C19H30F3NO3Si |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | (1S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-1-[4-(trifluoromethoxy)phenyl]ethanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCN(C[C@@H](O)c2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C19H30F3NO3Si/c1-18(2,3)27(4,5)26-16-10-11-23(12-16)13-17(24)14-6-8-15(9-7-14)25-19(20,21)22/h6-9,16-17,24H,10-13H2,1-5H3/t16-,17+/m0/s1 |
| InChIKey | JEHDFAGIPUVWKB-DLBZAZTESA-N |
| XLogP | 4.71 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|