C18H21FN2O2 — CID 167793847
1-(4-fluorophenyl)-2-[3-(pyridin-4-ylmethoxy)pyrrolidin-1-yl]ethanol (PubChem CID 167793847) has the molecular formula C18H21FN2O2 and a molecular weight of 316.38 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-[3-(pyridin-4-ylmethoxy)pyrrolidin-1-yl]ethanol.
| Compound Name | 1-(4-fluorophenyl)-2-[3-(pyridin-4-ylmethoxy)pyrrolidin-1-yl]ethanol |
|---|---|
| PubChem CID | 167793847 |
| Molecular Formula | C18H21FN2O2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1-(4-fluorophenyl)-2-[3-(pyridin-4-ylmethoxy)pyrrolidin-1-yl]ethanol |
| SMILES | OC(CN1CCC(OCc2ccncc2)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H21FN2O2/c19-16-3-1-15(2-4-16)18(22)12-21-10-7-17(11-21)23-13-14-5-8-20-9-6-14/h1-6,8-9,17-18,22H,7,10-13H2 |
| InChIKey | BDCPKVFHBYOVGX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |