C26H40N2O2Si — CID 54559728
(1S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-N-methyl-1-(3-phenylmethoxyphenyl)ethanamine (PubChem CID 54559728) has the molecular formula C26H40N2O2Si and a molecular weight of 440.70 g/mol. Its IUPAC name is (1S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-N-methyl-1-(3-phenylmethoxyphenyl)ethanamine.
| Compound Name | (1S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-N-methyl-1-(3-phenylmethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 54559728 |
| Molecular Formula | C26H40N2O2Si |
| Molecular Weight | 440.70 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | (1S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-N-methyl-1-(3-phenylmethoxyphenyl)ethanamine |
| SMILES | CN[C@H](CN1CC[C@H](O[Si](C)(C)C(C)(C)C)C1)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C26H40N2O2Si/c1-26(2,3)31(5,6)30-24-15-16-28(18-24)19-25(27-4)22-13-10-14-23(17-22)29-20-21-11-8-7-9-12-21/h7-14,17,24-25,27H,15-16,18-20H2,1-6H3/t24-,25+/m0/s1 |
| InChIKey | ZPRKXYGQUXXSJA-LOSJGSFVSA-N |
| XLogP | 5.62 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.70 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|