C28H43N3O3Si — CID 154420233
4-[[(1S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-1-phenylethyl]-methylamino]-2-ethoxybenzamide (PubChem CID 154420233) has the molecular formula C28H43N3O3Si and a molecular weight of 497.76 g/mol. Its IUPAC name is 4-[[(1S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-1-phenylethyl]-methylamino]-2-ethoxybenzamide.
| Compound Name | 4-[[(1S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-1-phenylethyl]-methylamino]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 154420233 |
| Molecular Formula | C28H43N3O3Si |
| Molecular Weight | 497.76 g/mol |
| Exact Mass | 497.31 |
| IUPAC Name | 4-[[(1S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-1-phenylethyl]-methylamino]-2-ethoxybenzamide |
| SMILES | CCOc1cc(N(C)[C@H](CN2CC[C@H](O[Si](C)(C)C(C)(C)C)C2)c2ccccc2)ccc1C(N)=O |
| InChI | InChI=1S/C28H43N3O3Si/c1-8-33-26-18-22(14-15-24(26)27(29)32)30(5)25(21-12-10-9-11-13-21)20-31-17-16-23(19-31)34-35(6,7)28(2,3)4/h9-15,18,23,25H,8,16-17,19-20H2,1-7H3,(H2,29,32)/t23-,25+/m0/s1 |
| InChIKey | XLWHKMUQFAKALP-UKILVPOCSA-N |
| XLogP | 5.46 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.76 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|