C22H27Cl2N3O3 — CID 139788085
2-(3,4-dichlorophenyl)-N-[(1S)-2-[(3S)-3-(methoxymethoxy)pyrrolidin-1-yl]-1-phenylethyl]acetohydrazide (PubChem CID 139788085) has the molecular formula C22H27Cl2N3O3 and a molecular weight of 452.38 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[(1S)-2-[(3S)-3-(methoxymethoxy)pyrrolidin-1-yl]-1-phenylethyl]acetohydrazide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[(1S)-2-[(3S)-3-(methoxymethoxy)pyrrolidin-1-yl]-1-phenylethyl]acetohydrazide |
|---|---|
| PubChem CID | 139788085 |
| Molecular Formula | C22H27Cl2N3O3 |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[(1S)-2-[(3S)-3-(methoxymethoxy)pyrrolidin-1-yl]-1-phenylethyl]acetohydrazide |
| SMILES | COCO[C@H]1CCN(C[C@H](c2ccccc2)N(N)C(=O)Cc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C22H27Cl2N3O3/c1-29-15-30-18-9-10-26(13-18)14-21(17-5-3-2-4-6-17)27(25)22(28)12-16-7-8-19(23)20(24)11-16/h2-8,11,18,21H,9-10,12-15,25H2,1H3/t18-,21+/m0/s1 |
| InChIKey | KTRCTGXFEIMHSI-GHTZIAJQSA-N |
| XLogP | 3.67 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|