C26H32Cl2N2O4 — CID 159839139
2-[3-[(3S)-1-[(2S)-2-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-2-phenylethyl]pyrrolidin-3-yl]propoxy]acetic acid (PubChem CID 159839139) has the molecular formula C26H32Cl2N2O4 and a molecular weight of 507.46 g/mol. Its IUPAC name is 2-[3-[(3S)-1-[(2S)-2-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-2-phenylethyl]pyrrolidin-3-yl]propoxy]acetic acid.
| Compound Name | 2-[3-[(3S)-1-[(2S)-2-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-2-phenylethyl]pyrrolidin-3-yl]propoxy]acetic acid |
|---|---|
| PubChem CID | 159839139 |
| Molecular Formula | C26H32Cl2N2O4 |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 2-[3-[(3S)-1-[(2S)-2-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-2-phenylethyl]pyrrolidin-3-yl]propoxy]acetic acid |
| SMILES | CN(C(=O)Cc1ccc(Cl)c(Cl)c1)[C@H](CN1CC[C@H](CCCOCC(=O)O)C1)c1ccccc1 |
| InChI | InChI=1S/C26H32Cl2N2O4/c1-29(25(31)15-20-9-10-22(27)23(28)14-20)24(21-7-3-2-4-8-21)17-30-12-11-19(16-30)6-5-13-34-18-26(32)33/h2-4,7-10,14,19,24H,5-6,11-13,15-18H2,1H3,(H,32,33)/t19-,24+/m0/s1 |
| InChIKey | NOLQKEBOKFVLHG-YADARESESA-N |
| XLogP | 4.94 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|