C22H26Cl2N2O4S — CID 121348107
[1-[2-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-2-phenylethyl]pyrrolidin-3-yl] methanesulfonate (PubChem CID 121348107) has the molecular formula C22H26Cl2N2O4S and a molecular weight of 485.43 g/mol. Its IUPAC name is [1-[2-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-2-phenylethyl]pyrrolidin-3-yl] methanesulfonate.
| Compound Name | [1-[2-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-2-phenylethyl]pyrrolidin-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 121348107 |
| Molecular Formula | C22H26Cl2N2O4S |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | [1-[2-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-2-phenylethyl]pyrrolidin-3-yl] methanesulfonate |
| SMILES | CN(C(=O)Cc1ccc(Cl)c(Cl)c1)C(CN1CCC(OS(C)(=O)=O)C1)c1ccccc1 |
| InChI | InChI=1S/C22H26Cl2N2O4S/c1-25(22(27)13-16-8-9-19(23)20(24)12-16)21(17-6-4-3-5-7-17)15-26-11-10-18(14-26)30-31(2,28)29/h3-9,12,18,21H,10-11,13-15H2,1-2H3 |
| InChIKey | UJNDWQBGYKBLKL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|