C21H23Cl2N5O — CID 121348073
N-[(1S)-2-[(3S)-3-azidopyrrolidin-1-yl]-1-phenylethyl]-2-(3,4-dichlorophenyl)-N-methylacetamide (PubChem CID 121348073) has the molecular formula C21H23Cl2N5O and a molecular weight of 432.36 g/mol. Its IUPAC name is N-[(1S)-2-[(3S)-3-azidopyrrolidin-1-yl]-1-phenylethyl]-2-(3,4-dichlorophenyl)-N-methylacetamide.
| Compound Name | N-[(1S)-2-[(3S)-3-azidopyrrolidin-1-yl]-1-phenylethyl]-2-(3,4-dichlorophenyl)-N-methylacetamide |
|---|---|
| PubChem CID | 121348073 |
| Molecular Formula | C21H23Cl2N5O |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | N-[(1S)-2-[(3S)-3-azidopyrrolidin-1-yl]-1-phenylethyl]-2-(3,4-dichlorophenyl)-N-methylacetamide |
| SMILES | CN(C(=O)Cc1ccc(Cl)c(Cl)c1)[C@H](CN1CC[C@H](N=[N+]=[N-])C1)c1ccccc1 |
| InChI | InChI=1S/C21H23Cl2N5O/c1-27(21(29)12-15-7-8-18(22)19(23)11-15)20(16-5-3-2-4-6-16)14-28-10-9-17(13-28)25-26-24/h2-8,11,17,20H,9-10,12-14H2,1H3/t17-,20+/m0/s1 |
| InChIKey | NVGWIEISYYFZDX-FXAWDEMLSA-N |
| XLogP | 5.12 |
| TPSA | 72.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|