C25H34ClN3O3 — CID 70202118
N-(3-chloropropyl)-2-[[(1S)-2-[(3S)-3-(methoxymethoxy)pyrrolidin-1-yl]-1-phenylethyl]-methylamino]benzamide (PubChem CID 70202118) has the molecular formula C25H34ClN3O3 and a molecular weight of 460.02 g/mol. Its IUPAC name is N-(3-chloropropyl)-2-[[(1S)-2-[(3S)-3-(methoxymethoxy)pyrrolidin-1-yl]-1-phenylethyl]-methylamino]benzamide.
| Compound Name | N-(3-chloropropyl)-2-[[(1S)-2-[(3S)-3-(methoxymethoxy)pyrrolidin-1-yl]-1-phenylethyl]-methylamino]benzamide |
|---|---|
| PubChem CID | 70202118 |
| Molecular Formula | C25H34ClN3O3 |
| Molecular Weight | 460.02 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | N-(3-chloropropyl)-2-[[(1S)-2-[(3S)-3-(methoxymethoxy)pyrrolidin-1-yl]-1-phenylethyl]-methylamino]benzamide |
| SMILES | COCO[C@H]1CCN(C[C@H](c2ccccc2)N(C)c2ccccc2C(=O)NCCCCl)C1 |
| InChI | InChI=1S/C25H34ClN3O3/c1-28(23-12-7-6-11-22(23)25(30)27-15-8-14-26)24(20-9-4-3-5-10-20)18-29-16-13-21(17-29)32-19-31-2/h3-7,9-12,21,24H,8,13-19H2,1-2H3,(H,27,30)/t21-,24+/m0/s1 |
| InChIKey | KELLJYYKEBBWMX-XUZZJYLKSA-N |
| XLogP | 3.92 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.02 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|