C23H30ClN3O2 — CID 22992920
3-chloro-4-[[2-(3-hydroxypyrrolidin-1-yl)-1-phenylethyl]-methylamino]-N-propylbenzamide (PubChem CID 22992920) has the molecular formula C23H30ClN3O2 and a molecular weight of 415.97 g/mol. Its IUPAC name is 3-chloro-4-[[2-(3-hydroxypyrrolidin-1-yl)-1-phenylethyl]-methylamino]-N-propylbenzamide.
| Compound Name | 3-chloro-4-[[2-(3-hydroxypyrrolidin-1-yl)-1-phenylethyl]-methylamino]-N-propylbenzamide |
|---|---|
| PubChem CID | 22992920 |
| Molecular Formula | C23H30ClN3O2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 3-chloro-4-[[2-(3-hydroxypyrrolidin-1-yl)-1-phenylethyl]-methylamino]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1ccc(N(C)C(CN2CCC(O)C2)c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C23H30ClN3O2/c1-3-12-25-23(29)18-9-10-21(20(24)14-18)26(2)22(17-7-5-4-6-8-17)16-27-13-11-19(28)15-27/h4-10,14,19,22,28H,3,11-13,15-16H2,1-2H3,(H,25,29) |
| InChIKey | HORXIGQZECFGHU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |