C23H26F5N3O2 — CID 20640568
4-[[(1S)-2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-phenylethyl]-methylamino]-N-(2,2,3,3,3-pentafluoropropyl)benzamide (PubChem CID 20640568) has the molecular formula C23H26F5N3O2 and a molecular weight of 471.47 g/mol. Its IUPAC name is 4-[[(1S)-2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-phenylethyl]-methylamino]-N-(2,2,3,3,3-pentafluoropropyl)benzamide.
| Compound Name | 4-[[(1S)-2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-phenylethyl]-methylamino]-N-(2,2,3,3,3-pentafluoropropyl)benzamide |
|---|---|
| PubChem CID | 20640568 |
| Molecular Formula | C23H26F5N3O2 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 4-[[(1S)-2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-phenylethyl]-methylamino]-N-(2,2,3,3,3-pentafluoropropyl)benzamide |
| SMILES | CN(c1ccc(C(=O)NCC(F)(F)C(F)(F)F)cc1)[C@H](CN1CC[C@H](O)C1)c1ccccc1 |
| InChI | InChI=1S/C23H26F5N3O2/c1-30(20(16-5-3-2-4-6-16)14-31-12-11-19(32)13-31)18-9-7-17(8-10-18)21(33)29-15-22(24,25)23(26,27)28/h2-10,19-20,32H,11-15H2,1H3,(H,29,33)/t19-,20+/m0/s1 |
| InChIKey | JDTVFZLWLDTYKF-VQTJNVASSA-N |
| XLogP | 3.86 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|