C26H42O3Si — CID 23412581
(1R,4S,5R,7S,10R,11S,13S,14R,17R)-7-[tert-butyl(dimethyl)silyl]oxy-17-hydroxy-5,10,14-trimethylhexacyclo[12.2.1.01,11.04,10.05,7.013,15]heptadecan-16-one (PubChem CID 23412581) has the molecular formula C26H42O3Si and a molecular weight of 430.71 g/mol. Its IUPAC name is (1R,4S,5R,7S,10R,11S,13S,14R,17R)-7-[tert-butyl(dimethyl)silyl]oxy-17-hydroxy-5,10,14-trimethylhexacyclo[12.2.1.01,11.04,10.05,7.013,15]heptadecan-16-one.
| Compound Name | (1R,4S,5R,7S,10R,11S,13S,14R,17R)-7-[tert-butyl(dimethyl)silyl]oxy-17-hydroxy-5,10,14-trimethylhexacyclo[12.2.1.01,11.04,10.05,7.013,15]heptadecan-16-one |
|---|---|
| PubChem CID | 23412581 |
| Molecular Formula | C26H42O3Si |
| Molecular Weight | 430.71 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | (1R,4S,5R,7S,10R,11S,13S,14R,17R)-7-[tert-butyl(dimethyl)silyl]oxy-17-hydroxy-5,10,14-trimethylhexacyclo[12.2.1.01,11.04,10.05,7.013,15]heptadecan-16-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@]12CC[C@@]3(C)[C@@H]4C[C@H]5C6C(=O)[C@@]4(CC[C@@H]3[C@@]1(C)C2)[C@H](O)[C@@]65C |
| InChI | InChI=1S/C26H42O3Si/c1-21(2,3)30(7,8)29-25-12-11-22(4)16(23(25,5)14-25)9-10-26-17(22)13-15-18(19(26)27)24(15,6)20(26)28/h15-18,20,28H,9-14H2,1-8H3/t15-,16-,17-,18?,20+,22+,23+,24+,25-,26-/m0/s1 |
| InChIKey | RETQGKFZWPATMP-HWZSYCRQSA-N |
| XLogP | 5.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.71 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|