C24H40O3Si — CID 46863239
(1R,1'R,2S,3'S,5'R,8'S,10'S)-2-[tert-butyl(dimethyl)silyl]oxy-3'-hydroxy-5,5-dimethylspiro[cyclohexane-1,4'-tetracyclo[6.2.1.01,5.05,10]undecane]-2'-one (PubChem CID 46863239) has the molecular formula C24H40O3Si and a molecular weight of 404.67 g/mol. Its IUPAC name is (1R,1'R,2S,3'S,5'R,8'S,10'S)-2-[tert-butyl(dimethyl)silyl]oxy-3'-hydroxy-5,5-dimethylspiro[cyclohexane-1,4'-tetracyclo[6.2.1.01,5.05,10]undecane]-2'-one.
| Compound Name | (1R,1'R,2S,3'S,5'R,8'S,10'S)-2-[tert-butyl(dimethyl)silyl]oxy-3'-hydroxy-5,5-dimethylspiro[cyclohexane-1,4'-tetracyclo[6.2.1.01,5.05,10]undecane]-2'-one |
|---|---|
| PubChem CID | 46863239 |
| Molecular Formula | C24H40O3Si |
| Molecular Weight | 404.67 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | (1R,1'R,2S,3'S,5'R,8'S,10'S)-2-[tert-butyl(dimethyl)silyl]oxy-3'-hydroxy-5,5-dimethylspiro[cyclohexane-1,4'-tetracyclo[6.2.1.01,5.05,10]undecane]-2'-one |
| SMILES | CC1(C)CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]2(C1)[C@H](O)C(=O)[C@@]13C[C@H]4CC[C@@]21[C@@H]3C4 |
| InChI | InChI=1S/C24H40O3Si/c1-20(2,3)28(6,7)27-17-9-10-21(4,5)14-23(17)19(26)18(25)22-13-15-8-11-24(22,23)16(22)12-15/h15-17,19,26H,8-14H2,1-7H3/t15-,16+,17-,19+,22-,23-,24-/m0/s1 |
| InChIKey | XGGYVNFLYCAPLM-GEGNYTOKSA-N |
| XLogP | 5.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.67 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|