C20H28O3 — CID 23412577
(1S,4R,9S,10R,12R,13S,16S)-16-hydroxy-5,5,9,13-tetramethylpentacyclo[11.2.1.01,10.04,9.012,14]hexadecane-6,15-dione (PubChem CID 23412577) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (1S,4R,9S,10R,12R,13S,16S)-16-hydroxy-5,5,9,13-tetramethylpentacyclo[11.2.1.01,10.04,9.012,14]hexadecane-6,15-dione.
| Compound Name | (1S,4R,9S,10R,12R,13S,16S)-16-hydroxy-5,5,9,13-tetramethylpentacyclo[11.2.1.01,10.04,9.012,14]hexadecane-6,15-dione |
|---|---|
| PubChem CID | 23412577 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (1S,4R,9S,10R,12R,13S,16S)-16-hydroxy-5,5,9,13-tetramethylpentacyclo[11.2.1.01,10.04,9.012,14]hexadecane-6,15-dione |
| SMILES | CC1(C)C(=O)CC[C@]2(C)[C@H]3C[C@@H]4C5C(=O)[C@]3(CC[C@@H]12)[C@@H](O)[C@]54C |
| InChI | InChI=1S/C20H28O3/c1-17(2)11-5-8-20-12(18(11,3)7-6-13(17)21)9-10-14(15(20)22)19(10,4)16(20)23/h10-12,14,16,23H,5-9H2,1-4H3/t10-,11+,12-,14?,16+,18+,19+,20-/m1/s1 |
| InChIKey | NWOOYBPWWPOWNL-VCONPPKVSA-N |
| XLogP | 2.99 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |