C20H29ClO4 — CID 102056171
(1S,4S,9R,10S,12R,13S,16S)-16-(chloromethyl)-13,16-dihydroxy-5,5,9-trimethyltetracyclo[10.2.2.01,10.04,9]hexadecane-6,14-dione (PubChem CID 102056171) has the molecular formula C20H29ClO4 and a molecular weight of 368.90 g/mol. Its IUPAC name is (1S,4S,9R,10S,12R,13S,16S)-16-(chloromethyl)-13,16-dihydroxy-5,5,9-trimethyltetracyclo[10.2.2.01,10.04,9]hexadecane-6,14-dione.
| Compound Name | (1S,4S,9R,10S,12R,13S,16S)-16-(chloromethyl)-13,16-dihydroxy-5,5,9-trimethyltetracyclo[10.2.2.01,10.04,9]hexadecane-6,14-dione |
|---|---|
| PubChem CID | 102056171 |
| Molecular Formula | C20H29ClO4 |
| Molecular Weight | 368.90 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | (1S,4S,9R,10S,12R,13S,16S)-16-(chloromethyl)-13,16-dihydroxy-5,5,9-trimethyltetracyclo[10.2.2.01,10.04,9]hexadecane-6,14-dione |
| SMILES | CC1(C)C(=O)CC[C@]2(C)[C@@H]1CC[C@]13C[C@@](O)(CCl)[C@H](C[C@H]12)[C@H](O)C3=O |
| InChI | InChI=1S/C20H29ClO4/c1-17(2)12-4-7-19-9-20(25,10-21)11(15(23)16(19)24)8-13(19)18(12,3)6-5-14(17)22/h11-13,15,23,25H,4-10H2,1-3H3/t11-,12-,13+,15+,18-,19+,20-/m1/s1 |
| InChIKey | IDPDQCWHQJIUSK-RZXHAHPMSA-N |
| XLogP | 2.72 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.90 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|