C27H48O6Si — CID 70643533
[(4'R,7'aS)-5'-[(1R,2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-1-methylcyclohexyl]-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-4'-yl] acetate (PubChem CID 70643533) has the molecular formula C27H48O6Si and a molecular weight of 496.76 g/mol. Its IUPAC name is [(4'R,7'aS)-5'-[(1R,2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-1-methylcyclohexyl]-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-4'-yl] acetate.
| Compound Name | [(4'R,7'aS)-5'-[(1R,2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-1-methylcyclohexyl]-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-4'-yl] acetate |
|---|---|
| PubChem CID | 70643533 |
| Molecular Formula | C27H48O6Si |
| Molecular Weight | 496.76 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | [(4'R,7'aS)-5'-[(1R,2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-1-methylcyclohexyl]-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-4'-yl] acetate |
| SMILES | CC(=O)O[C@H]1C2CCC3(OCCO3)[C@@]2(C)CCC1[C@@]1(C)CC[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C27H48O6Si/c1-18(28)32-23-20(10-13-26(6)21(23)11-14-27(26)30-15-16-31-27)25(5)12-9-19(17-22(25)29)33-34(7,8)24(2,3)4/h19-23,29H,9-17H2,1-8H3/t19-,20?,21?,22-,23+,25+,26-/m0/s1 |
| InChIKey | XSSWYDARWAZKAC-LRGWFUSDSA-N |
| XLogP | 5.43 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.76 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|