C23H36O6S — CID 130402746
[(3'aR,4'R,5'R,7'aS)-7'a-methyl-5'-[(1S,2R,4S)-1-methyl-2-(2-oxoethyl)-4-sulfanyloxycyclohexyl]spiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-4'-yl] acetate (PubChem CID 130402746) has the molecular formula C23H36O6S and a molecular weight of 440.60 g/mol. Its IUPAC name is [(3'aR,4'R,5'R,7'aS)-7'a-methyl-5'-[(1S,2R,4S)-1-methyl-2-(2-oxoethyl)-4-sulfanyloxycyclohexyl]spiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-4'-yl] acetate.
| Compound Name | [(3'aR,4'R,5'R,7'aS)-7'a-methyl-5'-[(1S,2R,4S)-1-methyl-2-(2-oxoethyl)-4-sulfanyloxycyclohexyl]spiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-4'-yl] acetate |
|---|---|
| PubChem CID | 130402746 |
| Molecular Formula | C23H36O6S |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | [(3'aR,4'R,5'R,7'aS)-7'a-methyl-5'-[(1S,2R,4S)-1-methyl-2-(2-oxoethyl)-4-sulfanyloxycyclohexyl]spiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-4'-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]([C@@]2(C)CC[C@H](OS)C[C@@H]2CC=O)CC[C@@]2(C)[C@H]1CCC21OCCO1 |
| InChI | InChI=1S/C23H36O6S/c1-15(25)28-20-18(21(2)8-4-17(29-30)14-16(21)7-11-24)5-9-22(3)19(20)6-10-23(22)26-12-13-27-23/h11,16-20,30H,4-10,12-14H2,1-3H3/t16-,17-,18-,19-,20+,21-,22-/m0/s1 |
| InChIKey | HFVSRKSOMCNPRJ-GDLCRWSOSA-N |
| XLogP | 4.11 |
| TPSA | 71.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|