C23H38O6S — CID 118974769
[(3'aR,4'R,5'R,7'aS)-5'-[(1S,2S,4S)-2-(2-hydroxyethyl)-1-methyl-4-sulfanyloxycyclohexyl]-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-4'-yl] acetate (PubChem CID 118974769) has the molecular formula C23H38O6S and a molecular weight of 442.62 g/mol. Its IUPAC name is [(3'aR,4'R,5'R,7'aS)-5'-[(1S,2S,4S)-2-(2-hydroxyethyl)-1-methyl-4-sulfanyloxycyclohexyl]-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-4'-yl] acetate.
| Compound Name | [(3'aR,4'R,5'R,7'aS)-5'-[(1S,2S,4S)-2-(2-hydroxyethyl)-1-methyl-4-sulfanyloxycyclohexyl]-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-4'-yl] acetate |
|---|---|
| PubChem CID | 118974769 |
| Molecular Formula | C23H38O6S |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | [(3'aR,4'R,5'R,7'aS)-5'-[(1S,2S,4S)-2-(2-hydroxyethyl)-1-methyl-4-sulfanyloxycyclohexyl]-7'a-methylspiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-4'-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]([C@@]2(C)CC[C@H](OS)C[C@@H]2CCO)CC[C@@]2(C)[C@H]1CCC21OCCO1 |
| InChI | InChI=1S/C23H38O6S/c1-15(25)28-20-18(21(2)8-4-17(29-30)14-16(21)7-11-24)5-9-22(3)19(20)6-10-23(22)26-12-13-27-23/h16-20,24,30H,4-14H2,1-3H3/t16-,17-,18-,19-,20+,21-,22-/m0/s1 |
| InChIKey | UYWITKQHMOEMHX-GDLCRWSOSA-N |
| XLogP | 3.91 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|