C24H40O7S — CID 58103742
[(1S,2R,5S)-2-[(4'R,7'aS)-7'a-methyl-4'-(methylsulfonyloxymethyl)spiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-5'-yl]-2,5-dimethylcyclohexyl] acetate (PubChem CID 58103742) has the molecular formula C24H40O7S and a molecular weight of 472.64 g/mol. Its IUPAC name is [(1S,2R,5S)-2-[(4'R,7'aS)-7'a-methyl-4'-(methylsulfonyloxymethyl)spiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-5'-yl]-2,5-dimethylcyclohexyl] acetate.
| Compound Name | [(1S,2R,5S)-2-[(4'R,7'aS)-7'a-methyl-4'-(methylsulfonyloxymethyl)spiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-5'-yl]-2,5-dimethylcyclohexyl] acetate |
|---|---|
| PubChem CID | 58103742 |
| Molecular Formula | C24H40O7S |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | [(1S,2R,5S)-2-[(4'R,7'aS)-7'a-methyl-4'-(methylsulfonyloxymethyl)spiro[1,3-dioxolane-2,1'-3,3a,4,5,6,7-hexahydro-2H-indene]-5'-yl]-2,5-dimethylcyclohexyl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](C)CC[C@]1(C)C1CC[C@@]2(C)C(CCC23OCCO3)[C@@H]1COS(C)(=O)=O |
| InChI | InChI=1S/C24H40O7S/c1-16-6-9-22(3,21(14-16)31-17(2)25)19-7-10-23(4)20(18(19)15-30-32(5,26)27)8-11-24(23)28-12-13-29-24/h16,18-21H,6-15H2,1-5H3/t16-,18+,19?,20?,21-,22+,23-/m0/s1 |
| InChIKey | HAHRQNQITZAVBS-PRZSTYFTSA-N |
| XLogP | 3.91 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|