C27H48O5Si — CID 54453194
(10R,13S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-6,7-diol (PubChem CID 54453194) has the molecular formula C27H48O5Si and a molecular weight of 480.76 g/mol. Its IUPAC name is (10R,13S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-6,7-diol.
| Compound Name | (10R,13S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-6,7-diol |
|---|---|
| PubChem CID | 54453194 |
| Molecular Formula | C27H48O5Si |
| Molecular Weight | 480.76 g/mol |
| Exact Mass | 480.33 |
| IUPAC Name | (10R,13S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-6,7-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC[C@@]2(C)C(C1)C(O)C(O)C1C2CC[C@@]2(C)C1CCC21OCCO1 |
| InChI | InChI=1S/C27H48O5Si/c1-24(2,3)33(6,7)32-17-8-11-25(4)18-9-12-26(5)19(10-13-27(26)30-14-15-31-27)21(18)23(29)22(28)20(25)16-17/h17-23,28-29H,8-16H2,1-7H3/t17?,18?,19?,20?,21?,22?,23?,25-,26+/m1/s1 |
| InChIKey | WWJGFOUIUBTESW-HMJIIFEKSA-N |
| XLogP | 5.10 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.76 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|