C22H45NO7Si — CID 11784518
2-[(7S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-1,4-dioxaspiro[4.5]decan-7-yl]-3-(methoxymethoxy)-2-(methoxymethoxymethyl)propan-1-amine (PubChem CID 11784518) has the molecular formula C22H45NO7Si and a molecular weight of 463.69 g/mol. Its IUPAC name is 2-[(7S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-1,4-dioxaspiro[4.5]decan-7-yl]-3-(methoxymethoxy)-2-(methoxymethoxymethyl)propan-1-amine.
| Compound Name | 2-[(7S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-1,4-dioxaspiro[4.5]decan-7-yl]-3-(methoxymethoxy)-2-(methoxymethoxymethyl)propan-1-amine |
|---|---|
| PubChem CID | 11784518 |
| Molecular Formula | C22H45NO7Si |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.30 |
| IUPAC Name | 2-[(7S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-1,4-dioxaspiro[4.5]decan-7-yl]-3-(methoxymethoxy)-2-(methoxymethoxymethyl)propan-1-amine |
| SMILES | COCOCC(CN)(COCOC)[C@@H]1CC2(CC[C@@H]1O[Si](C)(C)C(C)(C)C)OCCO2 |
| InChI | InChI=1S/C22H45NO7Si/c1-20(2,3)31(6,7)30-19-8-9-22(28-10-11-29-22)12-18(19)21(13-23,14-26-16-24-4)15-27-17-25-5/h18-19H,8-17,23H2,1-7H3/t18-,19+/m1/s1 |
| InChIKey | LXLWYMXQAKDEKO-MOPGFXCFSA-N |
| XLogP | 3.11 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|