C21H34BrNO4Si — CID 10838174
[(7R,8S)-7-[2-(bromomethyl)-6-methoxy-3-pyridinyl]-1,4-dioxaspiro[4.5]decan-8-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10838174) has the molecular formula C21H34BrNO4Si and a molecular weight of 472.50 g/mol. Its IUPAC name is [(7R,8S)-7-[2-(bromomethyl)-6-methoxy-3-pyridinyl]-1,4-dioxaspiro[4.5]decan-8-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(7R,8S)-7-[2-(bromomethyl)-6-methoxy-3-pyridinyl]-1,4-dioxaspiro[4.5]decan-8-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10838174 |
| Molecular Formula | C21H34BrNO4Si |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | [(7R,8S)-7-[2-(bromomethyl)-6-methoxy-3-pyridinyl]-1,4-dioxaspiro[4.5]decan-8-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COc1ccc([C@H]2CC3(CC[C@@H]2O[Si](C)(C)C(C)(C)C)OCCO3)c(CBr)n1 |
| InChI | InChI=1S/C21H34BrNO4Si/c1-20(2,3)28(5,6)27-18-9-10-21(25-11-12-26-21)13-16(18)15-7-8-19(24-4)23-17(15)14-22/h7-8,16,18H,9-14H2,1-6H3/t16-,18+/m1/s1 |
| InChIKey | FQUPGAUCIOXNKD-AEFFLSMTSA-N |
| XLogP | 5.39 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|