C28H42O2Si — CID 10939067
tert-butyl-[[(1R,4S,5S,10S)-14-methoxy-4-methyl-5-pentacyclo[8.7.3.01,9.04,8.012,17]icosa-8,12(17),13,15-tetraenyl]oxy]-dimethylsilane (PubChem CID 10939067) has the molecular formula C28H42O2Si and a molecular weight of 438.73 g/mol. Its IUPAC name is tert-butyl-[[(1R,4S,5S,10S)-14-methoxy-4-methyl-5-pentacyclo[8.7.3.01,9.04,8.012,17]icosa-8,12(17),13,15-tetraenyl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,4S,5S,10S)-14-methoxy-4-methyl-5-pentacyclo[8.7.3.01,9.04,8.012,17]icosa-8,12(17),13,15-tetraenyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 10939067 |
| Molecular Formula | C28H42O2Si |
| Molecular Weight | 438.73 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | tert-butyl-[[(1R,4S,5S,10S)-14-methoxy-4-methyl-5-pentacyclo[8.7.3.01,9.04,8.012,17]icosa-8,12(17),13,15-tetraenyl]oxy]-dimethylsilane |
| SMILES | COc1ccc2c(c1)C[C@@H]1CCC[C@@]23CC[C@@]2(C)C(=C13)CC[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H42O2Si/c1-26(2,3)31(6,7)30-24-13-12-23-25-19-9-8-14-28(25,16-15-27(23,24)4)22-11-10-21(29-5)18-20(22)17-19/h10-11,18-19,24H,8-9,12-17H2,1-7H3/t19-,24-,27-,28+/m0/s1 |
| InChIKey | NMRYBCTVOHWQFQ-ORQXCSHSSA-N |
| XLogP | 7.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.73 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|