C26H42O3Si — CID 11475940
(7S,8R,9S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-7,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-7-ol (PubChem CID 11475940) has the molecular formula C26H42O3Si and a molecular weight of 430.71 g/mol. Its IUPAC name is (7S,8R,9S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-7,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-7-ol.
| Compound Name | (7S,8R,9S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-7,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-7-ol |
|---|---|
| PubChem CID | 11475940 |
| Molecular Formula | C26H42O3Si |
| Molecular Weight | 430.71 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | (7S,8R,9S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-7,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-7-ol |
| SMILES | COc1ccc2c(c1)C[C@](C)(O)[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C26H42O3Si/c1-24(2,3)30(7,8)29-22-12-11-21-23-20(13-14-25(21,22)4)19-10-9-18(28-6)15-17(19)16-26(23,5)27/h9-10,15,20-23,27H,11-14,16H2,1-8H3/t20-,21+,22+,23-,25+,26+/m1/s1 |
| InChIKey | SJWUWVSIKUCXOV-AHXXJLMOSA-N |
| XLogP | 6.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.71 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|