C33H60O4Si2 — CID 155929220
tert-butyl-[[(1S,2R,4S,13S,16S)-6-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)-5,9-dimethyl-14-methylidene-16-tetracyclo[11.2.1.01,10.04,9]hexadec-5-enyl]oxy]-dimethylsilane (PubChem CID 155929220) has the molecular formula C33H60O4Si2 and a molecular weight of 577.01 g/mol. Its IUPAC name is tert-butyl-[[(1S,2R,4S,13S,16S)-6-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)-5,9-dimethyl-14-methylidene-16-tetracyclo[11.2.1.01,10.04,9]hexadec-5-enyl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,2R,4S,13S,16S)-6-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)-5,9-dimethyl-14-methylidene-16-tetracyclo[11.2.1.01,10.04,9]hexadec-5-enyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 155929220 |
| Molecular Formula | C33H60O4Si2 |
| Molecular Weight | 577.01 g/mol |
| Exact Mass | 576.40 |
| IUPAC Name | tert-butyl-[[(1S,2R,4S,13S,16S)-6-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)-5,9-dimethyl-14-methylidene-16-tetracyclo[11.2.1.01,10.04,9]hexadec-5-enyl]oxy]-dimethylsilane |
| SMILES | C=C1C[C@@]23C(CC[C@@H]1[C@@H]2O[Si](C)(C)C(C)(C)C)C1(C)CCC(O[Si](C)(C)C(C)(C)C)=C(C)[C@H]1C[C@H]3OCOC |
| InChI | InChI=1S/C33H60O4Si2/c1-22-20-33-27(16-15-24(22)29(33)37-39(13,14)31(6,7)8)32(9)18-17-26(36-38(11,12)30(3,4)5)23(2)25(32)19-28(33)35-21-34-10/h24-25,27-29H,1,15-21H2,2-14H3/t24-,25+,27?,28+,29-,32?,33-/m0/s1 |
| InChIKey | FHYBUIAVPCZONL-RSAMBDBESA-N |
| XLogP | 9.45 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.01 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|