C18H32O5Si — CID 11046512
(3aR,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-3a-(methoxymethoxymethyl)-7-methyl-3,4,5,7a-tetrahydro-2-benzofuran-1-one (PubChem CID 11046512) has the molecular formula C18H32O5Si and a molecular weight of 356.54 g/mol. Its IUPAC name is (3aR,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-3a-(methoxymethoxymethyl)-7-methyl-3,4,5,7a-tetrahydro-2-benzofuran-1-one.
| Compound Name | (3aR,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-3a-(methoxymethoxymethyl)-7-methyl-3,4,5,7a-tetrahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 11046512 |
| Molecular Formula | C18H32O5Si |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (3aR,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-3a-(methoxymethoxymethyl)-7-methyl-3,4,5,7a-tetrahydro-2-benzofuran-1-one |
| SMILES | COCOC[C@@]12CCC(O[Si](C)(C)C(C)(C)C)=C(C)[C@@H]1C(=O)OC2 |
| InChI | InChI=1S/C18H32O5Si/c1-13-14(23-24(6,7)17(2,3)4)8-9-18(10-21-12-20-5)11-22-16(19)15(13)18/h15H,8-12H2,1-7H3/t15-,18-/m1/s1 |
| InChIKey | BBKPKVZUPGONLP-CRAIPNDOSA-N |
| XLogP | 3.86 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|