C18H30O8 — CID 102159256
[7-hydroxy-7-(methoxymethoxymethyl)-5-methyl-9-[(2-methylpropan-2-yl)oxy]-2-oxo-3-oxabicyclo[3.2.2]nonan-6-yl] acetate (PubChem CID 102159256) has the molecular formula C18H30O8 and a molecular weight of 374.43 g/mol. Its IUPAC name is [7-hydroxy-7-(methoxymethoxymethyl)-5-methyl-9-[(2-methylpropan-2-yl)oxy]-2-oxo-3-oxabicyclo[3.2.2]nonan-6-yl] acetate.
| Compound Name | [7-hydroxy-7-(methoxymethoxymethyl)-5-methyl-9-[(2-methylpropan-2-yl)oxy]-2-oxo-3-oxabicyclo[3.2.2]nonan-6-yl] acetate |
|---|---|
| PubChem CID | 102159256 |
| Molecular Formula | C18H30O8 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | [7-hydroxy-7-(methoxymethoxymethyl)-5-methyl-9-[(2-methylpropan-2-yl)oxy]-2-oxo-3-oxabicyclo[3.2.2]nonan-6-yl] acetate |
| SMILES | COCOCC1(O)C2CC(OC(C)(C)C)C(C)(COC2=O)C1OC(C)=O |
| InChI | InChI=1S/C18H30O8/c1-11(19)25-15-17(5)8-24-14(20)12(7-13(17)26-16(2,3)4)18(15,21)9-23-10-22-6/h12-13,15,21H,7-10H2,1-6H3 |
| InChIKey | BMBMEQKWDYFSPZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|