C28H44O7 — CID 15385805
[(1R,2R,3S,7S,8S,10R,11R)-11-hydroxy-10-(methoxymethoxy)-8,12,15,15-tetramethyl-4-methylidene-7-[(2-methylpropan-2-yl)oxy]-14-oxo-2-tricyclo[9.3.1.03,8]pentadec-12-enyl] acetate (PubChem CID 15385805) has the molecular formula C28H44O7 and a molecular weight of 492.65 g/mol. Its IUPAC name is [(1R,2R,3S,7S,8S,10R,11R)-11-hydroxy-10-(methoxymethoxy)-8,12,15,15-tetramethyl-4-methylidene-7-[(2-methylpropan-2-yl)oxy]-14-oxo-2-tricyclo[9.3.1.03,8]pentadec-12-enyl] acetate.
| Compound Name | [(1R,2R,3S,7S,8S,10R,11R)-11-hydroxy-10-(methoxymethoxy)-8,12,15,15-tetramethyl-4-methylidene-7-[(2-methylpropan-2-yl)oxy]-14-oxo-2-tricyclo[9.3.1.03,8]pentadec-12-enyl] acetate |
|---|---|
| PubChem CID | 15385805 |
| Molecular Formula | C28H44O7 |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | [(1R,2R,3S,7S,8S,10R,11R)-11-hydroxy-10-(methoxymethoxy)-8,12,15,15-tetramethyl-4-methylidene-7-[(2-methylpropan-2-yl)oxy]-14-oxo-2-tricyclo[9.3.1.03,8]pentadec-12-enyl] acetate |
| SMILES | C=C1CC[C@H](OC(C)(C)C)[C@@]2(C)C[C@@H](OCOC)[C@@]3(O)C(C)=CC(=O)[C@@H]([C@H](OC(C)=O)[C@@H]12)C3(C)C |
| InChI | InChI=1S/C28H44O7/c1-16-11-12-20(35-25(4,5)6)27(9)14-21(33-15-32-10)28(31)17(2)13-19(30)23(26(28,7)8)24(22(16)27)34-18(3)29/h13,20-24,31H,1,11-12,14-15H2,2-10H3/t20-,21+,22+,23-,24+,27+,28-/m0/s1 |
| InChIKey | GVWYGQTVIBXIBQ-DUAAYJQVSA-N |
| XLogP | 4.37 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|