C27H39NO4SSi — CID 135012281
(6S,11R)-9-[tert-butyl(dimethyl)silyl]oxy-10-methyl-2-(4-methylphenyl)sulfonyl-11-prop-1-ynyl-2-azaspiro[5.5]undec-9-en-1-one (PubChem CID 135012281) has the molecular formula C27H39NO4SSi and a molecular weight of 501.77 g/mol. Its IUPAC name is (6S,11R)-9-[tert-butyl(dimethyl)silyl]oxy-10-methyl-2-(4-methylphenyl)sulfonyl-11-prop-1-ynyl-2-azaspiro[5.5]undec-9-en-1-one.
| Compound Name | (6S,11R)-9-[tert-butyl(dimethyl)silyl]oxy-10-methyl-2-(4-methylphenyl)sulfonyl-11-prop-1-ynyl-2-azaspiro[5.5]undec-9-en-1-one |
|---|---|
| PubChem CID | 135012281 |
| Molecular Formula | C27H39NO4SSi |
| Molecular Weight | 501.77 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | (6S,11R)-9-[tert-butyl(dimethyl)silyl]oxy-10-methyl-2-(4-methylphenyl)sulfonyl-11-prop-1-ynyl-2-azaspiro[5.5]undec-9-en-1-one |
| SMILES | CC#C[C@@H]1C(C)=C(O[Si](C)(C)C(C)(C)C)CC[C@@]12CCCN(S(=O)(=O)c1ccc(C)cc1)C2=O |
| InChI | InChI=1S/C27H39NO4SSi/c1-9-11-23-21(3)24(32-34(7,8)26(4,5)6)16-18-27(23)17-10-19-28(25(27)29)33(30,31)22-14-12-20(2)13-15-22/h12-15,23H,10,16-19H2,1-8H3/t23-,27+/m1/s1 |
| InChIKey | DPOKZXKIKHZHSB-KCWPFWIISA-N |
| XLogP | 6.02 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.77 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|