C19H21NO3S2 — CID 10248904
3-methyl-1-(4-methylphenyl)sulfonyl-3-phenylsulfanylpiperidin-2-one (PubChem CID 10248904) has the molecular formula C19H21NO3S2 and a molecular weight of 375.52 g/mol. Its IUPAC name is 3-methyl-1-(4-methylphenyl)sulfonyl-3-phenylsulfanylpiperidin-2-one.
| Compound Name | 3-methyl-1-(4-methylphenyl)sulfonyl-3-phenylsulfanylpiperidin-2-one |
|---|---|
| PubChem CID | 10248904 |
| Molecular Formula | C19H21NO3S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 3-methyl-1-(4-methylphenyl)sulfonyl-3-phenylsulfanylpiperidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(C)(Sc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C19H21NO3S2/c1-15-9-11-17(12-10-15)25(22,23)20-14-6-13-19(2,18(20)21)24-16-7-4-3-5-8-16/h3-5,7-12H,6,13-14H2,1-2H3 |
| InChIKey | MUVWJMBQHWTHMA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |