C22H23NO3S2 — CID 101247076
6-(4-methylphenyl)sulfonyl-9-phenylsulfanyl-6-azaspiro[4.5]dec-8-en-7-one (PubChem CID 101247076) has the molecular formula C22H23NO3S2 and a molecular weight of 413.56 g/mol. Its IUPAC name is 6-(4-methylphenyl)sulfonyl-9-phenylsulfanyl-6-azaspiro[4.5]dec-8-en-7-one.
| Compound Name | 6-(4-methylphenyl)sulfonyl-9-phenylsulfanyl-6-azaspiro[4.5]dec-8-en-7-one |
|---|---|
| PubChem CID | 101247076 |
| Molecular Formula | C22H23NO3S2 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 6-(4-methylphenyl)sulfonyl-9-phenylsulfanyl-6-azaspiro[4.5]dec-8-en-7-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)C=C(Sc3ccccc3)CC23CCCC3)cc1 |
| InChI | InChI=1S/C22H23NO3S2/c1-17-9-11-20(12-10-17)28(25,26)23-21(24)15-19(16-22(23)13-5-6-14-22)27-18-7-3-2-4-8-18/h2-4,7-12,15H,5-6,13-14,16H2,1H3 |
| InChIKey | GDMLLOQGQOWGFD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |