C31H56O6Si2 — CID 102041496
methyl (3S,3aS,5R,10aR,10bR)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(methoxymethoxy)-3a-methyl-2,3,4,5,7,10,10a,10b-octahydro-1H-cyclohepta[e]indene-8-carboxylate (PubChem CID 102041496) has the molecular formula C31H56O6Si2 and a molecular weight of 580.96 g/mol. Its IUPAC name is methyl (3S,3aS,5R,10aR,10bR)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(methoxymethoxy)-3a-methyl-2,3,4,5,7,10,10a,10b-octahydro-1H-cyclohepta[e]indene-8-carboxylate.
| Compound Name | methyl (3S,3aS,5R,10aR,10bR)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(methoxymethoxy)-3a-methyl-2,3,4,5,7,10,10a,10b-octahydro-1H-cyclohepta[e]indene-8-carboxylate |
|---|---|
| PubChem CID | 102041496 |
| Molecular Formula | C31H56O6Si2 |
| Molecular Weight | 580.96 g/mol |
| Exact Mass | 580.36 |
| IUPAC Name | methyl (3S,3aS,5R,10aR,10bR)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(methoxymethoxy)-3a-methyl-2,3,4,5,7,10,10a,10b-octahydro-1H-cyclohepta[e]indene-8-carboxylate |
| SMILES | COCO[C@H]1CC[C@@H]2[C@H]3CC(O[Si](C)(C)C(C)(C)C)=C(C(=O)OC)CC=C3[C@H](O[Si](C)(C)C(C)(C)C)C[C@]12C |
| InChI | InChI=1S/C31H56O6Si2/c1-29(2,3)38(10,11)36-25-18-23-21(14-15-22(25)28(32)34-9)26(37-39(12,13)30(4,5)6)19-31(7)24(23)16-17-27(31)35-20-33-8/h14,23-24,26-27H,15-20H2,1-13H3/t23-,24+,26+,27-,31-/m0/s1 |
| InChIKey | WRKGXJPJZFIESA-VQOCZXJYSA-N |
| XLogP | 7.97 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.96 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|