C23H40O3Si — CID 99771675
methyl (6S)-6-[2-[(5R)-5-[tert-butyl(dimethyl)silyl]oxycyclopenten-1-yl]ethyl]-2,6-dimethylcyclohexene-1-carboxylate (PubChem CID 99771675) has the molecular formula C23H40O3Si and a molecular weight of 392.66 g/mol. Its IUPAC name is methyl (6S)-6-[2-[(5R)-5-[tert-butyl(dimethyl)silyl]oxycyclopenten-1-yl]ethyl]-2,6-dimethylcyclohexene-1-carboxylate.
| Compound Name | methyl (6S)-6-[2-[(5R)-5-[tert-butyl(dimethyl)silyl]oxycyclopenten-1-yl]ethyl]-2,6-dimethylcyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 99771675 |
| Molecular Formula | C23H40O3Si |
| Molecular Weight | 392.66 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | methyl (6S)-6-[2-[(5R)-5-[tert-butyl(dimethyl)silyl]oxycyclopenten-1-yl]ethyl]-2,6-dimethylcyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C(C)CCC[C@@]1(C)CCC1=CCC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H40O3Si/c1-17-11-10-15-23(5,20(17)21(24)25-6)16-14-18-12-9-13-19(18)26-27(7,8)22(2,3)4/h12,19H,9-11,13-16H2,1-8H3/t19-,23+/m1/s1 |
| InChIKey | IDQQECRJGBNFGJ-XXBNENTESA-N |
| XLogP | 6.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.66 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|