C26H44O3Si — CID 90741491
[(3S,13S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 90741491) has the molecular formula C26H44O3Si and a molecular weight of 432.72 g/mol. Its IUPAC name is [(3S,13S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(3S,13S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 90741491 |
| Molecular Formula | C26H44O3Si |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | [(3S,13S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCC2C3CC=C4C[C@@H](O[Si](C)(C)C(C)(C)C)CCC4C3CC[C@@]21C |
| InChI | InChI=1S/C26H44O3Si/c1-17(27)28-24-13-12-23-22-10-8-18-16-19(29-30(6,7)25(2,3)4)9-11-20(18)21(22)14-15-26(23,24)5/h8,19-24H,9-16H2,1-7H3/t19-,20?,21?,22?,23?,24-,26-/m0/s1 |
| InChIKey | RRYCQKUNOLXOAP-HEASEPIISA-N |
| XLogP | 6.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|