C18H27NO2 — CID 23267717
[(5aS,6S,8aS)-5a-methyl-3,3a,3b,4,5,6,7,8,8a,8b,9,10-dodecahydro-2H-indeno[5,4-e]indol-6-yl] acetate (PubChem CID 23267717) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is [(5aS,6S,8aS)-5a-methyl-3,3a,3b,4,5,6,7,8,8a,8b,9,10-dodecahydro-2H-indeno[5,4-e]indol-6-yl] acetate.
| Compound Name | [(5aS,6S,8aS)-5a-methyl-3,3a,3b,4,5,6,7,8,8a,8b,9,10-dodecahydro-2H-indeno[5,4-e]indol-6-yl] acetate |
|---|---|
| PubChem CID | 23267717 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | [(5aS,6S,8aS)-5a-methyl-3,3a,3b,4,5,6,7,8,8a,8b,9,10-dodecahydro-2H-indeno[5,4-e]indol-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@H]2C3CCC4=NCCC4C3CC[C@]12C |
| InChI | InChI=1S/C18H27NO2/c1-11(20)21-17-6-4-15-13-3-5-16-14(8-10-19-16)12(13)7-9-18(15,17)2/h12-15,17H,3-10H2,1-2H3/t12?,13?,14?,15-,17-,18-/m0/s1 |
| InChIKey | OABJQQJLXNQNLE-PYDUDLIASA-N |
| XLogP | 3.62 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |