C28H44O6 — CID 166038741
(3aR,5aR,6S)-3a,5a-dimethyl-1-propan-2-yl-9-propyl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,7,10,10a-octahydrocyclohepta[e]indene-8-carbaldehyde (PubChem CID 166038741) has the molecular formula C28H44O6 and a molecular weight of 476.65 g/mol. Its IUPAC name is (3aR,5aR,6S)-3a,5a-dimethyl-1-propan-2-yl-9-propyl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,7,10,10a-octahydrocyclohepta[e]indene-8-carbaldehyde.
| Compound Name | (3aR,5aR,6S)-3a,5a-dimethyl-1-propan-2-yl-9-propyl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,7,10,10a-octahydrocyclohepta[e]indene-8-carbaldehyde |
|---|---|
| PubChem CID | 166038741 |
| Molecular Formula | C28H44O6 |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.31 |
| IUPAC Name | (3aR,5aR,6S)-3a,5a-dimethyl-1-propan-2-yl-9-propyl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,7,10,10a-octahydrocyclohepta[e]indene-8-carbaldehyde |
| SMILES | CCCC1=C(C=O)C[C@H](O[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)[C@]2(C)CC[C@@]3(C)CCC(C(C)C)=C3C2C1 |
| InChI | InChI=1S/C28H44O6/c1-6-7-17-12-20-23-19(16(2)3)8-9-27(23,4)10-11-28(20,5)22(13-18(17)14-29)34-26-25(32)24(31)21(30)15-33-26/h14,16,20-22,24-26,30-32H,6-13,15H2,1-5H3/t20?,21-,22+,24+,25-,26+,27-,28-/m1/s1 |
| InChIKey | UTDITDRAKHHBTG-KOKGTMKFSA-N |
| XLogP | 4.07 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|